CAS 1820570-00-0 is the registry number for (1R,2R)-2-(Difluoromethoxy)cyclohexan-1-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Trans-(1R,2R)-2-(difluoromethoxy)cyclohexan-1-amine (CAS 1820570-00-0) is a chemical compound with the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. IUPAC name: trans-(1R,2R)-2-(difluoromethoxy)cyclohexan-1-amine. InChIKey: DOMHTRAXANSGMB-PHDIDXHHSA-N.
| Molecular formula | C7H13F2NO |
|---|---|
| Molecular weight | 165.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-(difluoromethoxy)cyclohexan-1-amine |
| InChIKey | DOMHTRAXANSGMB-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)OC(F)F |
Computed by PubChem (NCBI)