Products 1820574-86-4
CAS 1820574-86-4 is the registry number for tert-Butyl rac-(1r,3r,5s)-8h-spiro[8-azabicyclo[3.2.1]octane-3,2'-[1,4]oxazinane]-8-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Tert-butyl (1R,5S)-spiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate (CAS 1820574-86-4) is a chemical compound with the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. IUPAC name: tert-butyl (1R,5S)-spiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate. InChIKey: SWXVOKDTXKRXKI-ODOQXGPZSA-N.
| Molecular formula | C15H26N2O3 |
|---|---|
| Molecular weight | 282.38 g/mol |
| IUPAC name | tert-butyl (1R,5S)-spiro[8-azabicyclo[3.2.1]octane-3,2'-morpholine]-8-carboxylate |
| InChIKey | SWXVOKDTXKRXKI-ODOQXGPZSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC3(C2)CNCCO3 |
Computed by PubChem (NCBI)