Products 1824026-97-2

CAS 1824026-97-2 is the registry number for tert-Butyl 2-oxo-[1,3'-bipiperidine]-1'-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 3-(2-oxopiperidin-1-yl)piperidine-1-carboxylate (CAS 1824026-97-2) is a chemical compound with the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. IUPAC name: tert-butyl 3-(2-oxopiperidin-1-yl)piperidine-1-carboxylate. InChIKey: ONCRXZDTPJQRQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O3
Molecular weight282.38 g/mol
IUPAC nametert-butyl 3-(2-oxopiperidin-1-yl)piperidine-1-carboxylate
InChIKeyONCRXZDTPJQRQQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC(C1)N2CCCCC2=O

Computed by PubChem (NCBI)