CAS 2381956-07-4 is the registry number for Racemic-(5s,6s)-tert-butyl 6-ethyl-2-oxo-1,7-diazaspiro[4.5]decane-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Tert-butyl (5S,10S)-10-ethyl-2-oxo-1,9-diazaspiro[4.5]decane-9-carboxylate (CAS 2381956-07-4) is a chemical compound with the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. IUPAC name: tert-butyl (5S,10S)-10-ethyl-2-oxo-1,9-diazaspiro[4.5]decane-9-carboxylate. InChIKey: YSUAHAFTZWOXES-NHYWBVRUSA-N.
| Molecular formula | C15H26N2O3 |
|---|---|
| Molecular weight | 282.38 g/mol |
| IUPAC name | tert-butyl (5S,10S)-10-ethyl-2-oxo-1,9-diazaspiro[4.5]decane-9-carboxylate |
| InChIKey | YSUAHAFTZWOXES-NHYWBVRUSA-N |
| SMILES | CC[C@H]1[C@]2(CCCN1C(=O)OC(C)(C)C)CCC(=O)N2 |
Computed by PubChem (NCBI)