Products 486-87-3
CAS 486-87-3 appears in our catalog under these names: α-isolupanine, Alpha-isolupanine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 5mg.
(1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (CAS 486-87-3) is a chemical compound with the molecular formula C15H24N2O and a molecular weight of 248.36 g/mol. IUPAC name: (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one. InChIKey: JYIJIIVLEOETIQ-IGQOVBAYSA-N.
| Molecular formula | C15H24N2O |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | (1S,2R,9S,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| InChIKey | JYIJIIVLEOETIQ-IGQOVBAYSA-N |
| SMILES | C1CCN2C[C@@H]3C[C@H]([C@H]2C1)CN4[C@@H]3CCCC4=O |
Computed by PubChem (NCBI)