CAS 1820579-99-4 is the registry number for (1S,2S)-cyclohexane-1,2-diamine 1,4-dimethyl (2S,3S)-2,3-dihydroxybutanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Dimethyl (2S,3S)-2,3-dihydroxybutanedioate;trans-(1S,2S)-cyclohexane-1,2-diamine (CAS 1820579-99-4) is a chemical compound with the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. IUPAC name: dimethyl (2S,3S)-2,3-dihydroxybutanedioate;trans-(1S,2S)-cyclohexane-1,2-diamine. InChIKey: WENLISPLRQXWAY-YFZLMZGGSA-N.
| Molecular formula | C12H24N2O6 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | dimethyl (2S,3S)-2,3-dihydroxybutanedioate;trans-(1S,2S)-cyclohexane-1,2-diamine |
| InChIKey | WENLISPLRQXWAY-YFZLMZGGSA-N |
| SMILES | COC(=O)[C@H]([C@@H](C(=O)OC)O)O.C1CC[C@@H]([C@H](C1)N)N |
Computed by PubChem (NCBI)