Products 1864072-41-2

CAS 1864072-41-2 is the registry number for 2-(Methoxymethyl)azetidine hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Bis(2-(methoxymethyl)azetidine);oxalic acid (CAS 1864072-41-2) is a chemical compound with the molecular formula C12H24N2O6 and a molecular weight of 292.33 g/mol. IUPAC name: bis(2-(methoxymethyl)azetidine);oxalic acid. InChIKey: BEXZLPKIIUXDRX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H24N2O6
Molecular weight292.33 g/mol
IUPAC namebis(2-(methoxymethyl)azetidine);oxalic acid
InChIKeyBEXZLPKIIUXDRX-UHFFFAOYSA-N
SMILESCOCC1CCN1.COCC1CCN1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)