CAS 1820580-38-8 appears in our catalog under these names: (2R,3S)-2-Methylmorpholine-3-carboxamide hydrochloride, 95%, (2R,3S)-2-Methylmorpholine-3-carboxamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2R,3S)-2-methylmorpholine-3-carboxamide;hydrochloride (CAS 1820580-38-8) is a chemical compound with the molecular formula C6H13ClN2O2 and a molecular weight of 180.63 g/mol. IUPAC name: (2R,3S)-2-methylmorpholine-3-carboxamide;hydrochloride. InChIKey: HOCDMTIGVSEGKN-JBUOLDKXSA-N.
| Molecular formula | C6H13ClN2O2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | (2R,3S)-2-methylmorpholine-3-carboxamide;hydrochloride |
| InChIKey | HOCDMTIGVSEGKN-JBUOLDKXSA-N |
| SMILES | C[C@@H]1[C@H](NCCO1)C(=O)N.Cl |
Computed by PubChem (NCBI)