CAS 1820580-58-2 is the registry number for (2S,3S)-2-(1-(3-Methoxypropyl)-1H-pyrazol-5-yl)tetrahydrofuran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxylic acid (CAS 1820580-58-2) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: (2S,3S)-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxylic acid. InChIKey: CZEHKRUNLXFVRU-ONGXEEELSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (2S,3S)-2-[2-(3-methoxypropyl)pyrazol-3-yl]oxolane-3-carboxylic acid |
| InChIKey | CZEHKRUNLXFVRU-ONGXEEELSA-N |
| SMILES | COCCCN1C(=CC=N1)[C@@H]2[C@H](CCO2)C(=O)O |
Computed by PubChem (NCBI)