CAS 1820580-91-3 is the registry number for (2R,3S)-2-(1-Methylpiperidin-4-yl)tetrahydrofuran-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-(1-methylpiperidin-4-yl)oxolane-3-carboxylic acid;hydrochloride (CAS 1820580-91-3) is a chemical compound with the molecular formula C11H20ClNO3 and a molecular weight of 249.73 g/mol. IUPAC name: (2R,3S)-2-(1-methylpiperidin-4-yl)oxolane-3-carboxylic acid;hydrochloride. InChIKey: AQLFASZDMRZRHU-BAUSSPIASA-N.
| Molecular formula | C11H20ClNO3 |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | (2R,3S)-2-(1-methylpiperidin-4-yl)oxolane-3-carboxylic acid;hydrochloride |
| InChIKey | AQLFASZDMRZRHU-BAUSSPIASA-N |
| SMILES | CN1CCC(CC1)[C@@H]2[C@H](CCO2)C(=O)O.Cl |
Computed by PubChem (NCBI)