Products 1837321-86-4

CAS 1837321-86-4 is the registry number for 1-(3,3-Dimethylbutanoyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1837321-86-4) is a chemical compound with the molecular formula C11H20ClNO3 and a molecular weight of 249.73 g/mol. IUPAC name: 1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: VXLVSCNRIUFACE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20ClNO3
Molecular weight249.73 g/mol
IUPAC name1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid;hydrochloride
InChIKeyVXLVSCNRIUFACE-UHFFFAOYSA-N
SMILESCC(C)(C)CC(=O)N1CCC(C1)C(=O)O.Cl

Computed by PubChem (NCBI)