CAS 1837321-86-4 is the registry number for 1-(3,3-Dimethylbutanoyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1837321-86-4) is a chemical compound with the molecular formula C11H20ClNO3 and a molecular weight of 249.73 g/mol. IUPAC name: 1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: VXLVSCNRIUFACE-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO3 |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 1-(3,3-dimethylbutanoyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | VXLVSCNRIUFACE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)N1CCC(C1)C(=O)O.Cl |
Computed by PubChem (NCBI)