Products 1820612-84-7
CAS 1820612-84-7 is the registry number for 2-amino-5,6,7-trifluoro-1,3-benzoxazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-5,6,7-trifluoro-1,3-benzoxazole-4-carboxylic acid (CAS 1820612-84-7) is a chemical compound with the molecular formula C8H3F3N2O3 and a molecular weight of 232.12 g/mol. IUPAC name: 2-amino-5,6,7-trifluoro-1,3-benzoxazole-4-carboxylic acid. InChIKey: KAUKHLBETRXQMK-UHFFFAOYSA-N.
| Molecular formula | C8H3F3N2O3 |
|---|---|
| Molecular weight | 232.12 g/mol |
| IUPAC name | 2-amino-5,6,7-trifluoro-1,3-benzoxazole-4-carboxylic acid |
| InChIKey | KAUKHLBETRXQMK-UHFFFAOYSA-N |
| SMILES | C1(=C2C(=C(C(=C1F)F)F)OC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)