Products 1003708-58-4
CAS 1003708-58-4 is the registry number for 2-Nitro-5-(trifluoromethoxy)benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-nitro-5-(trifluoromethoxy)benzonitrile (CAS 1003708-58-4) is a chemical compound with the molecular formula C8H3F3N2O3 and a molecular weight of 232.12 g/mol. IUPAC name: 2-nitro-5-(trifluoromethoxy)benzonitrile. InChIKey: STFMZRHACYMUGG-UHFFFAOYSA-N.
| Molecular formula | C8H3F3N2O3 |
|---|---|
| Molecular weight | 232.12 g/mol |
| IUPAC name | 2-nitro-5-(trifluoromethoxy)benzonitrile |
| InChIKey | STFMZRHACYMUGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)