CAS 573759-00-9 is the registry number for 4-Nitro-2-(trifluoromethyl)benzo[d]oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-nitro-2-(trifluoromethyl)-1,3-benzoxazole (CAS 573759-00-9) is a chemical compound with the molecular formula C8H3F3N2O3 and a molecular weight of 232.12 g/mol. IUPAC name: 4-nitro-2-(trifluoromethyl)-1,3-benzoxazole. InChIKey: MVYGNYLHXPFQJV-UHFFFAOYSA-N.
| Molecular formula | C8H3F3N2O3 |
|---|---|
| Molecular weight | 232.12 g/mol |
| IUPAC name | 4-nitro-2-(trifluoromethyl)-1,3-benzoxazole |
| InChIKey | MVYGNYLHXPFQJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(=N2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)