Products 1820613-59-9
CAS 1820613-59-9 is the registry number for 5-chloro-2-(1H-pyrazol-4-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-chloro-2-(1H-pyrazol-4-yl)aniline (CAS 1820613-59-9) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 5-chloro-2-(1H-pyrazol-4-yl)aniline. InChIKey: SBXNYKGKBGNSJB-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 5-chloro-2-(1H-pyrazol-4-yl)aniline |
| InChIKey | SBXNYKGKBGNSJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C2=CNN=C2 |
Computed by PubChem (NCBI)