Products 1820615-13-1

CAS 1820615-13-1 is the registry number for methyl 2-(3-{4-[(piperidin-1-yl)carbonyl]phenyl}phenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[3-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetate (CAS 1820615-13-1) is a chemical compound with the molecular formula C21H23NO3 and a molecular weight of 337.4 g/mol. IUPAC name: methyl 2-[3-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetate. InChIKey: WIOQEVSBRLIRGO-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO3
Molecular weight337.4 g/mol
IUPAC namemethyl 2-[3-[4-(piperidine-1-carbonyl)phenyl]phenyl]acetate
InChIKeyWIOQEVSBRLIRGO-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC(=CC=C1)C2=CC=C(C=C2)C(=O)N3CCCCC3

Computed by PubChem (NCBI)