Products 6581-06-2

CAS 6581-06-2 is the registry number for Clidinium Bromide Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2,2-diphenylacetate (CAS 6581-06-2) is a chemical compound with the molecular formula C21H23NO3 and a molecular weight of 337.4 g/mol. IUPAC name: 1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2,2-diphenylacetate. InChIKey: HGMITUYOCPPQLE-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO3
Molecular weight337.4 g/mol
IUPAC name1-azabicyclo[2.2.2]octan-3-yl 2-hydroxy-2,2-diphenylacetate
InChIKeyHGMITUYOCPPQLE-UHFFFAOYSA-N
SMILESC1CN2CCC1C(C2)OC(=O)C(C3=CC=CC=C3)(C4=CC=CC=C4)O

Computed by PubChem (NCBI)