Products 1820618-21-0

CAS 1820618-21-0 is the registry number for 2-Chloro-4,5,6,7-tetrahydro-benzothiazole-6-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate (CAS 1820618-21-0) is a chemical compound with the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. IUPAC name: ethyl 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate. InChIKey: DRHJCGYWKNJZPL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO2S
Molecular weight245.73 g/mol
IUPAC nameethyl 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate
InChIKeyDRHJCGYWKNJZPL-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCC2=C(C1)SC(=N2)Cl

Computed by PubChem (NCBI)