CAS 1820618-21-0 is the registry number for 2-Chloro-4,5,6,7-tetrahydro-benzothiazole-6-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate (CAS 1820618-21-0) is a chemical compound with the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. IUPAC name: ethyl 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate. InChIKey: DRHJCGYWKNJZPL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2S |
|---|---|
| Molecular weight | 245.73 g/mol |
| IUPAC name | ethyl 2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylate |
| InChIKey | DRHJCGYWKNJZPL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC2=C(C1)SC(=N2)Cl |
Computed by PubChem (NCBI)