CAS 82222-74-0 appears in our catalog under these names: 4–(4–Chlorophenyl)thiomorpholine 1,1–Dioxide, 4-(4-Chlorophenyl)thiomorpholine 1,1-Dioxide, >98.0%(GC)(T), 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide 98%, 4-(4-Chlorophenyl)thiomorpholine 1,1-dioxide, 98%, 98%, 4-(4-Chlorophenyl)thiomorpholine-1,1-dioxide, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.
4-(4-chlorophenyl)-1,4-thiazinane 1,1-dioxide (CAS 82222-74-0) is a chemical compound with the molecular formula C10H12ClNO2S and a molecular weight of 245.73 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,4-thiazinane 1,1-dioxide. InChIKey: IQIXFXLKPNFQGQ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2S |
|---|---|
| Molecular weight | 245.73 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,4-thiazinane 1,1-dioxide |
| InChIKey | IQIXFXLKPNFQGQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)