Products 2404734-34-3

CAS 2404734-34-3 is the registry number for 3-Bromo-2-ethoxy-5-isopropylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-2-ethoxy-5-propan-2-ylbenzoic acid (CAS 2404734-34-3) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: 3-bromo-2-ethoxy-5-propan-2-ylbenzoic acid. InChIKey: LAGWMZAVLCVHIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrO3
Molecular weight287.15 g/mol
IUPAC name3-bromo-2-ethoxy-5-propan-2-ylbenzoic acid
InChIKeyLAGWMZAVLCVHIZ-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1Br)C(C)C)C(=O)O

Computed by PubChem (NCBI)