CAS 1820641-93-7 appears in our catalog under these names: S-Acetyl-peg2-t-butyl ester, 95%, S-acetyl-PEG2-Boc, S–acetyl–PEG2–Boc, S-Acetyl-peg2-t-butyl ester 98%, 1,1-Dimethylethyl 3-[2-[2-(acetylthio)ethoxy]ethoxy]propanoate, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 10mg, 100mg, 5g, 100 mg, 500 mg, 1 g.
Tert-butyl 3-[2-(2-acetylsulfanylethoxy)ethoxy]propanoate (CAS 1820641-93-7) is a chemical compound with the molecular formula C13H24O5S and a molecular weight of 292.39 g/mol. IUPAC name: tert-butyl 3-[2-(2-acetylsulfanylethoxy)ethoxy]propanoate. InChIKey: DSBKYHJZFUGMFX-UHFFFAOYSA-N.
| Molecular formula | C13H24O5S |
|---|---|
| Molecular weight | 292.39 g/mol |
| IUPAC name | tert-butyl 3-[2-(2-acetylsulfanylethoxy)ethoxy]propanoate |
| InChIKey | DSBKYHJZFUGMFX-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)