CAS 2234308-24-6 is the registry number for Methyl 2,2,4,4-Tetramethyl-6-((methylsulfonyl)oxy)cyclohexanecarboxylate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2,2,4,4-tetramethyl-6-methylsulfonyloxycyclohexane-1-carboxylate (CAS 2234308-24-6) is a chemical compound with the molecular formula C13H24O5S and a molecular weight of 292.39 g/mol. IUPAC name: methyl 2,2,4,4-tetramethyl-6-methylsulfonyloxycyclohexane-1-carboxylate. InChIKey: QRRBFIMTBKQMOI-UHFFFAOYSA-N.
| Molecular formula | C13H24O5S |
|---|---|
| Molecular weight | 292.39 g/mol |
| IUPAC name | methyl 2,2,4,4-tetramethyl-6-methylsulfonyloxycyclohexane-1-carboxylate |
| InChIKey | QRRBFIMTBKQMOI-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(C(C1)(C)C)C(=O)OC)OS(=O)(=O)C)C |
Computed by PubChem (NCBI)