CAS 1820647-10-6 appears in our catalog under these names: 4,5,6,7-Tetrahydro-1,3-benzothiazole-2,4-diamine dihydrochloride, 95%, 4,5,6,7-Tetrahydro-1,3-benzothiazole-2,4-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine;dihydrochloride (CAS 1820647-10-6) is a chemical compound with the molecular formula C7H13Cl2N3S and a molecular weight of 242.17 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine;dihydrochloride. InChIKey: AJWNRDRXPWZZQB-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3S |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1,3-benzothiazole-2,4-diamine;dihydrochloride |
| InChIKey | AJWNRDRXPWZZQB-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)SC(=N2)N)N.Cl.Cl |
Computed by PubChem (NCBI)