CAS 492431-13-7 appears in our catalog under these names: 1-(2-Thiazolyl)piperazine dihydrochloride, 95%, 2-(Piperazin-1-yl)thiazole dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-piperazin-1-yl-1,3-thiazole;dihydrochloride (CAS 492431-13-7) is a chemical compound with the molecular formula C7H13Cl2N3S and a molecular weight of 242.17 g/mol. IUPAC name: 2-piperazin-1-yl-1,3-thiazole;dihydrochloride. InChIKey: LUTXGFQJZYAWFJ-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3S |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | 2-piperazin-1-yl-1,3-thiazole;dihydrochloride |
| InChIKey | LUTXGFQJZYAWFJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CS2.Cl.Cl |
Computed by PubChem (NCBI)