Products 1820647-19-5

CAS 1820647-19-5 is the registry number for Methyl 4-bromo-3-hydrazinylbenzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-3-hydrazinylbenzoate;hydrochloride (CAS 1820647-19-5) is a chemical compound with the molecular formula C8H10BrClN2O2 and a molecular weight of 281.53 g/mol. IUPAC name: methyl 4-bromo-3-hydrazinylbenzoate;hydrochloride. InChIKey: JGXKYKJGJSNAOH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BrClN2O2
Molecular weight281.53 g/mol
IUPAC namemethyl 4-bromo-3-hydrazinylbenzoate;hydrochloride
InChIKeyJGXKYKJGJSNAOH-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)Br)NN.Cl

Computed by PubChem (NCBI)