CAS 1820675-03-3 is the registry number for 5-Bromo-2-(dimethylamino)pyridine-3-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride (CAS 1820675-03-3) is a chemical compound with the molecular formula C8H10BrClN2O2 and a molecular weight of 281.53 g/mol. IUPAC name: 5-bromo-2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride. InChIKey: FHKRECDDRGKDFZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2O2 |
|---|---|
| Molecular weight | 281.53 g/mol |
| IUPAC name | 5-bromo-2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | FHKRECDDRGKDFZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=N1)Br)C(=O)O.Cl |
Computed by PubChem (NCBI)