Products 1820675-03-3

CAS 1820675-03-3 is the registry number for 5-Bromo-2-(dimethylamino)pyridine-3-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-bromo-2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride (CAS 1820675-03-3) is a chemical compound with the molecular formula C8H10BrClN2O2 and a molecular weight of 281.53 g/mol. IUPAC name: 5-bromo-2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride. InChIKey: FHKRECDDRGKDFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BrClN2O2
Molecular weight281.53 g/mol
IUPAC name5-bromo-2-(dimethylamino)pyridine-3-carboxylic acid;hydrochloride
InChIKeyFHKRECDDRGKDFZ-UHFFFAOYSA-N
SMILESCN(C)C1=C(C=C(C=N1)Br)C(=O)O.Cl

Computed by PubChem (NCBI)