CAS 1820648-49-4 is the registry number for (1-(2,2,2-Trifluoroethyl)piperidin-3-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride (CAS 1820648-49-4) is a chemical compound with the molecular formula C8H17Cl2F3N2 and a molecular weight of 269.13 g/mol. IUPAC name: [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride. InChIKey: YUACIXJZQCARNC-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2F3N2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | [1-(2,2,2-trifluoroethyl)piperidin-3-yl]methanamine;dihydrochloride |
| InChIKey | YUACIXJZQCARNC-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC(F)(F)F)CN.Cl.Cl |
Computed by PubChem (NCBI)