Products 2222518-34-3
CAS 2222518-34-3 is the registry number for 1-(1,1,1-Trifluoropropan-2-yl)piperidin-4-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine;dihydrochloride (CAS 2222518-34-3) is a chemical compound with the molecular formula C8H17Cl2F3N2 and a molecular weight of 269.13 g/mol. IUPAC name: 1-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine;dihydrochloride. InChIKey: RXIULCILDDVONF-UHFFFAOYSA-N.
| Molecular formula | C8H17Cl2F3N2 |
|---|---|
| Molecular weight | 269.13 g/mol |
| IUPAC name | 1-(1,1,1-trifluoropropan-2-yl)piperidin-4-amine;dihydrochloride |
| InChIKey | RXIULCILDDVONF-UHFFFAOYSA-N |
| SMILES | CC(C(F)(F)F)N1CCC(CC1)N.Cl.Cl |
Computed by PubChem (NCBI)