CAS 1820648-97-2 appears in our catalog under these names: 2-Bromo-4-nitrobenzene-1,3-diol, 97%, 2-Bromo-4-nitrobenzene-1,3-diol, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-4-nitrobenzene-1,3-diol (CAS 1820648-97-2) is a chemical compound with the molecular formula C6H4BrNO4 and a molecular weight of 234.00 g/mol. IUPAC name: 2-bromo-4-nitrobenzene-1,3-diol. InChIKey: RBZPILPWQWFMNE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO4 |
|---|---|
| Molecular weight | 234.00 g/mol |
| IUPAC name | 2-bromo-4-nitrobenzene-1,3-diol |
| InChIKey | RBZPILPWQWFMNE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])O)Br)O |
Computed by PubChem (NCBI)