CAS 671779-99-0 appears in our catalog under these names: 5-Bromo-3-nitrobenzene-1,2-diol, 95%, 5–Bromo–3–nitrobenzene–1,2–diol, 5-bromo-3-nitrobenzene-1,2-diol, 5-Bromo-3-nitrobenzene-1,2-diol 97%, 5-Bromo-3-nitro-1,2-benzenediol, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 2,5g, 5g.
5-bromo-3-nitrobenzene-1,2-diol (CAS 671779-99-0) is a chemical compound with the molecular formula C6H4BrNO4 and a molecular weight of 234.00 g/mol. IUPAC name: 5-bromo-3-nitrobenzene-1,2-diol. InChIKey: ZBOWHKUCFSOWHK-UHFFFAOYSA-N.
| Molecular formula | C6H4BrNO4 |
|---|---|
| Molecular weight | 234.00 g/mol |
| IUPAC name | 5-bromo-3-nitrobenzene-1,2-diol |
| InChIKey | ZBOWHKUCFSOWHK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)O)Br |
Computed by PubChem (NCBI)