CAS 1820665-78-8 appears in our catalog under these names: 7-Bromo-5-fluoro-1-methyl-3H-1,3-benzodiazol-2-one, 96%, 7-Bromo-5-fluoro-1-methyl-3H-1,3-benzodiazol-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 2,5g.
4-bromo-6-fluoro-3-methyl-1H-benzimidazol-2-one (CAS 1820665-78-8) is a chemical compound with the molecular formula C8H6BrFN2O and a molecular weight of 245.05 g/mol. IUPAC name: 4-bromo-6-fluoro-3-methyl-1H-benzimidazol-2-one. InChIKey: WAHHUZCZSLHKFH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFN2O |
|---|---|
| Molecular weight | 245.05 g/mol |
| IUPAC name | 4-bromo-6-fluoro-3-methyl-1H-benzimidazol-2-one |
| InChIKey | WAHHUZCZSLHKFH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2Br)F)NC1=O |
Computed by PubChem (NCBI)