Products 3026728-35-5
CAS 3026728-35-5 is the registry number for 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS 3026728-35-5) is a chemical compound with the molecular formula C8H6BrFN2O and a molecular weight of 245.05 g/mol. IUPAC name: 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine. InChIKey: MSCGMEDTWSRBLD-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFN2O |
|---|---|
| Molecular weight | 245.05 g/mol |
| IUPAC name | 3-bromo-4-fluoro-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | MSCGMEDTWSRBLD-UHFFFAOYSA-N |
| SMILES | COC1=CN=C2C(=C1F)C(=CN2)Br |
Computed by PubChem (NCBI)