CAS 1820666-12-3 appears in our catalog under these names: Oxalic acid, tert-butyl N-(1-amino-3-phenylpropan-2-yl)-N-methylcarbamate, 95%, Oxalic acid, tert-butyl N-(1-amino-3-phenylpropan-2-yl)-N-methylcarbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl N-(1-amino-3-phenylpropan-2-yl)-N-methylcarbamate;oxalic acid (CAS 1820666-12-3) is a chemical compound with the molecular formula C17H26N2O6 and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl N-(1-amino-3-phenylpropan-2-yl)-N-methylcarbamate;oxalic acid. InChIKey: PYNGGDGLSJCCHZ-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl N-(1-amino-3-phenylpropan-2-yl)-N-methylcarbamate;oxalic acid |
| InChIKey | PYNGGDGLSJCCHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C(CC1=CC=CC=C1)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)