Products 54767-76-9

CAS 54767-76-9 is the registry number for Bis(2-ethoxyethyl) (4-methyl-1,3-phenylene)dicarbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-ethoxyethyl N-[3-(2-ethoxyethoxycarbonylamino)-4-methylphenyl]carbamate (CAS 54767-76-9) is a chemical compound with the molecular formula C17H26N2O6 and a molecular weight of 354.4 g/mol. IUPAC name: 2-ethoxyethyl N-[3-(2-ethoxyethoxycarbonylamino)-4-methylphenyl]carbamate. InChIKey: XCEPDLGXLQKFCO-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26N2O6
Molecular weight354.4 g/mol
IUPAC name2-ethoxyethyl N-[3-(2-ethoxyethoxycarbonylamino)-4-methylphenyl]carbamate
InChIKeyXCEPDLGXLQKFCO-UHFFFAOYSA-N
SMILESCCOCCOC(=O)NC1=CC(=C(C=C1)C)NC(=O)OCCOCC

Computed by PubChem (NCBI)