Products 1820674-78-9
CAS 1820674-78-9 is the registry number for 6-bromo-7-chloro-8-methyl-4-oxo-1H-quinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-7-chloro-8-methyl-4-oxo-1H-quinoline-2-carboxylic acid (CAS 1820674-78-9) is a chemical compound with the molecular formula C11H7BrClNO3 and a molecular weight of 316.53 g/mol. IUPAC name: 6-bromo-7-chloro-8-methyl-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: RVCBJLOFQWBHFQ-UHFFFAOYSA-N.
| Molecular formula | C11H7BrClNO3 |
|---|---|
| Molecular weight | 316.53 g/mol |
| IUPAC name | 6-bromo-7-chloro-8-methyl-4-oxo-1H-quinoline-2-carboxylic acid |
| InChIKey | RVCBJLOFQWBHFQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C1Cl)Br)C(=O)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)