Products 2450997-56-3
CAS 2450997-56-3 is the registry number for Methyl 4-bromo-5-chloro-3-formyl-1H-indole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-5-chloro-3-formyl-1H-indole-2-carboxylate (CAS 2450997-56-3) is a chemical compound with the molecular formula C11H7BrClNO3 and a molecular weight of 316.53 g/mol. IUPAC name: methyl 4-bromo-5-chloro-3-formyl-1H-indole-2-carboxylate. InChIKey: XHGAFIQFCSJOKI-UHFFFAOYSA-N.
| Molecular formula | C11H7BrClNO3 |
|---|---|
| Molecular weight | 316.53 g/mol |
| IUPAC name | methyl 4-bromo-5-chloro-3-formyl-1H-indole-2-carboxylate |
| InChIKey | XHGAFIQFCSJOKI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CC(=C2Br)Cl)C=O |
Computed by PubChem (NCBI)