CAS 1931388-46-3 is the registry number for 3-(5-Bromo-2-chlorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-bromo-2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1931388-46-3) is a chemical compound with the molecular formula C11H7BrClNO3 and a molecular weight of 316.53 g/mol. IUPAC name: 3-(5-bromo-2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: UVFLWPBJMGCBOR-UHFFFAOYSA-N.
| Molecular formula | C11H7BrClNO3 |
|---|---|
| Molecular weight | 316.53 g/mol |
| IUPAC name | 3-(5-bromo-2-chlorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | UVFLWPBJMGCBOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC(=C2)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)