CAS 1820686-18-7 is the registry number for 4-Bromo-N,N-diisopropyl-3-methoxyaniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-bromo-3-methoxy-N,N-di(propan-2-yl)aniline (CAS 1820686-18-7) is a chemical compound with the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. IUPAC name: 4-bromo-3-methoxy-N,N-di(propan-2-yl)aniline. InChIKey: AISSPYUMCDROMZ-UHFFFAOYSA-N.
| Molecular formula | C13H20BrNO |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | 4-bromo-3-methoxy-N,N-di(propan-2-yl)aniline |
| InChIKey | AISSPYUMCDROMZ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC(=C(C=C1)Br)OC)C(C)C |
Computed by PubChem (NCBI)