CAS 924844-14-4 is the registry number for 3-Bromo-n,n-dimethyladamantane-1-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-N,N-dimethyladamantane-1-carboxamide (CAS 924844-14-4) is a chemical compound with the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. IUPAC name: 3-bromo-N,N-dimethyladamantane-1-carboxamide. InChIKey: XYZOZQYKVBDMDD-UHFFFAOYSA-N.
| Molecular formula | C13H20BrNO |
|---|---|
| Molecular weight | 286.21 g/mol |
| IUPAC name | 3-bromo-N,N-dimethyladamantane-1-carboxamide |
| InChIKey | XYZOZQYKVBDMDD-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C12CC3CC(C1)CC(C3)(C2)Br |
Computed by PubChem (NCBI)