Products 1820687-03-3
CAS 1820687-03-3 is the registry number for 4,6,8-Trichloroquinoline-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
4,6,8-trichloroquinoline-3-carboxylic acid (CAS 1820687-03-3) is a chemical compound with the molecular formula C10H4Cl3NO2 and a molecular weight of 276.5 g/mol. IUPAC name: 4,6,8-trichloroquinoline-3-carboxylic acid. InChIKey: XAUCCNHSIDWTLS-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl3NO2 |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | 4,6,8-trichloroquinoline-3-carboxylic acid |
| InChIKey | XAUCCNHSIDWTLS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NC=C(C(=C21)Cl)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)