CAS 1188051-42-4 is the registry number for 5-Chloro-3-(3,4-dichlorophenyl)isoxazole-4-carbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(3,4-dichlorophenyl)-1,2-oxazole-4-carbaldehyde (CAS 1188051-42-4) is a chemical compound with the molecular formula C10H4Cl3NO2 and a molecular weight of 276.5 g/mol. IUPAC name: 5-chloro-3-(3,4-dichlorophenyl)-1,2-oxazole-4-carbaldehyde. InChIKey: JZRKSRWVKRCLQR-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl3NO2 |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | 5-chloro-3-(3,4-dichlorophenyl)-1,2-oxazole-4-carbaldehyde |
| InChIKey | JZRKSRWVKRCLQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NOC(=C2C=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)