Products 1391053-30-7
CAS 1391053-30-7 is the registry number for 3,5,6-Trichloro-8-quinolinecarboxylic Acid. Offered by: TRC. Available pack sizes: 50mg, 5mg.
3,5,6-trichloroquinoline-8-carboxylic acid (CAS 1391053-30-7) is a chemical compound with the molecular formula C10H4Cl3NO2 and a molecular weight of 276.5 g/mol. IUPAC name: 3,5,6-trichloroquinoline-8-carboxylic acid. InChIKey: HGMQKAMHFFQHQY-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl3NO2 |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | 3,5,6-trichloroquinoline-8-carboxylic acid |
| InChIKey | HGMQKAMHFFQHQY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=C(C=C2C(=O)O)Cl)Cl)Cl |
Computed by PubChem (NCBI)