CAS 1820703-07-8 is the registry number for Methyl 1-((chlorosulfonyl)methyl)cyclopropane-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 1-(chlorosulfonylmethyl)cyclopropane-1-carboxylate (CAS 1820703-07-8) is a chemical compound with the molecular formula C6H9ClO4S and a molecular weight of 212.65 g/mol. IUPAC name: methyl 1-(chlorosulfonylmethyl)cyclopropane-1-carboxylate. InChIKey: LTJAEKFDGQPHKT-UHFFFAOYSA-N.
| Molecular formula | C6H9ClO4S |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | methyl 1-(chlorosulfonylmethyl)cyclopropane-1-carboxylate |
| InChIKey | LTJAEKFDGQPHKT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)