Products 59941-51-4
CAS 59941-51-4 is the registry number for 2-(Chlorosulfonyl)ethyl 2-methyl-2-propenoate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
2-chlorosulfonylethyl 2-methylprop-2-enoate (CAS 59941-51-4) is a chemical compound with the molecular formula C6H9ClO4S and a molecular weight of 212.65 g/mol. IUPAC name: 2-chlorosulfonylethyl 2-methylprop-2-enoate. InChIKey: OMPQLEFHXWWAHQ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClO4S |
|---|---|
| Molecular weight | 212.65 g/mol |
| IUPAC name | 2-chlorosulfonylethyl 2-methylprop-2-enoate |
| InChIKey | OMPQLEFHXWWAHQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCS(=O)(=O)Cl |
Computed by PubChem (NCBI)