CAS 1820704-76-4 appears in our catalog under these names: 5-Bromo-7-chloro-1,4-dihydroquinoxaline-2,3-dione, 96%, 5-Bromo-7-chloroquinoxaline-2,3(1H,4H)-dione, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
5-bromo-7-chloro-1,4-dihydroquinoxaline-2,3-dione (CAS 1820704-76-4) is a chemical compound with the molecular formula C8H4BrClN2O2 and a molecular weight of 275.48 g/mol. IUPAC name: 5-bromo-7-chloro-1,4-dihydroquinoxaline-2,3-dione. InChIKey: BDJGONAGKAPRQI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2O2 |
|---|---|
| Molecular weight | 275.48 g/mol |
| IUPAC name | 5-bromo-7-chloro-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | BDJGONAGKAPRQI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C(=O)N2)Br)Cl |
Computed by PubChem (NCBI)