CAS 2918766-69-3 is the registry number for 7-Bromo-6-chloro-4-hydroxy-1,5-naphthyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-6-chloro-4-hydroxy-1H-1,5-naphthyridin-2-one (CAS 2918766-69-3) is a chemical compound with the molecular formula C8H4BrClN2O2 and a molecular weight of 275.48 g/mol. IUPAC name: 7-bromo-6-chloro-4-hydroxy-1H-1,5-naphthyridin-2-one. InChIKey: ARICSPJIXVAEJU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2O2 |
|---|---|
| Molecular weight | 275.48 g/mol |
| IUPAC name | 7-bromo-6-chloro-4-hydroxy-1H-1,5-naphthyridin-2-one |
| InChIKey | ARICSPJIXVAEJU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Br)Cl)C(=CC(=O)N2)O |
Computed by PubChem (NCBI)