Products 1820704-98-0

CAS 1820704-98-0 is the registry number for methyl 2-fluoro-4-(6-methoxypyridin-3-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-fluoro-4-(6-methoxy-3-pyridinyl)benzoate (CAS 1820704-98-0) is a chemical compound with the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. IUPAC name: methyl 2-fluoro-4-(6-methoxy-3-pyridinyl)benzoate. InChIKey: TVUPIMXMTNBAJA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12FNO3
Molecular weight261.25 g/mol
IUPAC namemethyl 2-fluoro-4-(6-methoxy-3-pyridinyl)benzoate
InChIKeyTVUPIMXMTNBAJA-UHFFFAOYSA-N
SMILESCOC1=NC=C(C=C1)C2=CC(=C(C=C2)C(=O)OC)F

Computed by PubChem (NCBI)