CAS 1820705-04-1 is the registry number for 6-Bromo-3-chloro-2-fluoroaniline, n-boc protected, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-(6-bromo-3-chloro-2-fluorophenyl)carbamate (CAS 1820705-04-1) is a chemical compound with the molecular formula C11H12BrClFNO2 and a molecular weight of 324.57 g/mol. IUPAC name: tert-butyl N-(6-bromo-3-chloro-2-fluorophenyl)carbamate. InChIKey: APZIRQJSBLFXOZ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClFNO2 |
|---|---|
| Molecular weight | 324.57 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-3-chloro-2-fluorophenyl)carbamate |
| InChIKey | APZIRQJSBLFXOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1F)Cl)Br |
Computed by PubChem (NCBI)