Products 1820717-35-8
CAS 1820717-35-8 appears in our catalog under these names: Azido-peg1-ch2co2tbu, 98%, Azido–PEG1–C1–Boc, Azido-peg1-ch2co2tbu 95%, Azido-PEG1-C1-Boc, 1,1-Dimethylethyl 2-(2-azidoethoxy)acetate, 95%+, 95%+. Offered by: Combi-blocks, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 50 mg, 250 mg, 25 mg, 1 g.
Tert-butyl 2-(2-azidoethoxy)acetate (CAS 1820717-35-8) is a chemical compound with the molecular formula C8H15N3O3 and a molecular weight of 201.22 g/mol. IUPAC name: tert-butyl 2-(2-azidoethoxy)acetate. InChIKey: VYUUTJWBKOGROL-UHFFFAOYSA-N.
| Molecular formula | C8H15N3O3 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | tert-butyl 2-(2-azidoethoxy)acetate |
| InChIKey | VYUUTJWBKOGROL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCN=[N+]=[N-] |
Computed by PubChem (NCBI)