CAS 2892293-91-1 is the registry number for (S)-2-Amino-3-((S)-2,2-dimethyl-4-oxooxazolidin-5-yl)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]propanamide (CAS 2892293-91-1) is a chemical compound with the molecular formula C8H15N3O3 and a molecular weight of 201.22 g/mol. IUPAC name: (2S)-2-amino-3-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]propanamide. InChIKey: OYYOMOUGBJIFCA-WHFBIAKZSA-N.
| Molecular formula | C8H15N3O3 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (2S)-2-amino-3-[(5S)-2,2-dimethyl-4-oxo-1,3-oxazolidin-5-yl]propanamide |
| InChIKey | OYYOMOUGBJIFCA-WHFBIAKZSA-N |
| SMILES | CC1(NC(=O)[C@@H](O1)C[C@@H](C(=O)N)N)C |
Computed by PubChem (NCBI)